CAS 21453-69-0
:(+)-Syringaresinol
Description:
(+)-Syringaresinol is a lignan compound characterized by its unique chemical structure, which consists of two phenylpropanoid units linked by a carbon-carbon bond. It is derived from various plant sources, particularly from the genus Syringa, and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. The compound exhibits chirality, with the (+) designation indicating its specific optical activity. In terms of solubility, (+)-Syringaresinol is typically soluble in organic solvents but may have limited solubility in water. Its molecular formula reflects a relatively complex structure, contributing to its diverse interactions in biological systems. Research has suggested that it may play a role in plant defense mechanisms and has garnered interest for its potential therapeutic applications in human health. As with many natural products, the extraction and purification processes can influence its availability and concentration in various formulations. Overall, (+)-Syringaresinol represents a fascinating area of study within the field of natural products chemistry.
Formula:C22H26O8
InChI:InChI=1/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1
InChI key:InChIKey=KOWMJRJXZMEZLD-HCIHMXRSSA-N
SMILES:O(C)C=1C=C([C@@H]2[C@@]3([C@@]([C@H](OC3)C4=CC(OC)=C(O)C(OC)=C4)(CO2)[H])[H])C=C(OC)C1O
Synonyms:- (+)-Lirioresinol B
- (+)-Syringaresinol
- 1H,3H-Furo[3,4-c]furan, phenol deriv.
- 4,4′-[(1S,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2,6-dimethoxyphenol]
- NSC 329246
- Phenol, 4,4′-(3aα,4,6,6aα-tetrahydro-1H,3H-furo[3,4-c]furan-1α,4α-diyl)bis[2,6-dimethoxy-
- Phenol, 4,4′-(tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis[2,6-dimethoxy-, [1S-(1α,3aα,4α,6aα)]-
- phenol, 4,4'-[(1S,3aR,4S,6aR)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2,6-dimethoxy-
- 4,4'-((1S,3aR,4S,6aR)-hexahydrofuro[3,4-c]furan-1,4-diyl)bis(2,6-dimethoxyphenol)
- (1S,3aβ,6aβ)-Tetrahydro-1β,4β-bis(3,5-dimethoxy-4-hydroxyphenyl)-1H,3H-furo[3,4-c]furan
- 4,4'-[(1S,3aβ,6aβ)-Tetrahydro-1H,3H-furo[3,4-c]furan-1β,4β-diyl]bis(2,6-dimethoxyphenol)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,4'-((1S,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis(2,6-dimethoxyphenol)
CAS:4,4'-((1S,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis(2,6-dimethoxyphenol)Purity:99%Molecular weight:418.44g/mol(+)-Syringaresinol
CAS:(+)-Syringaresinol shows antioxidant potential, it exhibits cytoprotective activity in cultured MCF-7 cells stressed by H2O2.Formula:C22H26O8Purity:98%Color and Shape:SolidMolecular weight:418.44(+)-Syringaresinol, 98%
CAS:(+)-Syringaresinol, 98% is a lignan compound, which is a type of phenolic compound found in a variety of plant sources. It is primarily derived from the wood and bark of specific plant species, most notably those within the Syringa genus. The mode of action of (+)-Syringaresinol involves its function as an antioxidant, where it can scavenge free radicals and inhibit oxidative stress within biological systems.Formula:C22H26O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:418.44 g/mol(+)-Syringaresinol
CAS:Controlled ProductFormula:C22H26O8Color and Shape:NeatMolecular weight:418.437





