CAS 214535-51-0

(4-benzylpiperazin-1-yl)acetic acid dihydrochloride

Description:

(4-benzylpiperazin-1-yl)acetic acid dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to the piperazine ring, contributing to its lipophilicity and potential biological activity. The acetic acid moiety indicates that it possesses acidic properties, and the presence of two hydrochloride groups suggests that it is a salt form, enhancing its solubility in water. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. Its structure allows for interactions with various biological targets, potentially influencing neurotransmitter systems. As with many piperazine derivatives, it may also be investigated for its effects on central nervous system activity. Safety and handling precautions should be observed due to its chemical nature, and further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₂₀Cl₂N₂O₂

InChI: InChI=1/C13H18N2O2.2ClH/c16-13(17)11-15-8-6-14(7-9-15)10-12-4-2-1-3-5-12;;/h1-5H,6-11H2,(H,16,17);2*1H

SMILES: c1ccc(cc1)CN1CCN(CC1)CC(=O)O.Cl.Cl

2-(4-Benzylpiperazin-1-yl)acetic acid dihydrochloride

CAS: 214535-51-0

Versatile small molecule scaffold

Formula: C₁₃H₂₀Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 307.22 g/mol

Ref: 3D-PIA53551