CAS 214540-43-9

1-benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole

Description:

1-Benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole is a heterocyclic compound characterized by its triazole ring, which contains three nitrogen atoms and two carbon atoms. This compound features a benzyl group, which contributes to its hydrophobic characteristics, and halogen substituents, specifically bromine and fluorine, which can influence its reactivity and biological activity. The presence of the bromine atom typically enhances the compound's electrophilicity, while the fluorine atom can improve its lipophilicity and metabolic stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in various fields, including agrochemicals and pharmaceuticals. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the substituents, making it a valuable candidate for further research and development in synthetic chemistry.

Formula: C₉H₇BrFN₃

InChI: InChI=1/C9H7BrFN3/c10-8-12-9(11)14(13-8)6-7-4-2-1-3-5-7/h1-5H,6H2

SMILES: c1ccc(cc1)Cn1c(F)nc(Br)n1

1-Benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole

CAS: 214540-43-9

1-Benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole

Formula: C₉H₇BrFN₃

Purity: ≥95%

Color and Shape: yellow liquid

Molecular weight: 256.07g/mol

Ref: 54-PC4062