CAS 21461-84-7

(S)-(+)-5-Oxo-2-tetrahydrofurancarboxylic acid

Description:

(S)-(+)-5-Oxo-2-tetrahydrofurancarboxylic acid, with the CAS number 21461-84-7, is a chiral compound characterized by its tetrahydrofuran ring structure, which is a five-membered cyclic ether. This compound features a carboxylic acid functional group and a ketone group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chiral center indicates that it can exist in two enantiomeric forms, with the (S)-enantiomer being the specific configuration referenced in its name. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals due to its unique structural properties. Its solubility in polar solvents, such as water and alcohols, is notable, which facilitates its use in various chemical reactions. Additionally, the compound's ability to participate in further chemical transformations makes it a valuable intermediate in organic chemistry. As with many organic acids, it may exhibit acidic properties, influencing its behavior in different chemical environments.

Formula: C₅H₆O₄

InChI: InChI=1/C5H6O4/c6-4-2-1-3(9-4)5(7)8/h3H,1-2H2,(H,7,8)/p-1/t3-/m0/s1

SMILES: C1CC(=O)O[C@@H]1C(=O)[O-]

Synonyms:

• (2S)-5-oxotetrahydrofuran-2-carboxylic acid
• (2S)-5-oxotetrahydrofuran-2-carboxylate
• (S)-(+)-5-Oxotetrahydrofuran-2-Carboxylic Acid
• (2S)-5-oxooxolane-2-carboxylic acid

(S)-5-Oxotetrahydrofuran-2-carboxylic acid

CAS: 21461-84-7

Formula: C₅H₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 130.0987

Ref: IN-DA003CHK

(S)-5-Oxo-tetrahydrofuran-2-carboxylic acid

CAS: 21461-84-7

Formula: C₅H₆O₄

Purity: 95%

Color and Shape: Crystalline

Molecular weight: 130.099

Ref: 10-F221953

(S)-(+)-5-Oxotetrahydrofuran-2-carboxylic Acid

CAS: 21461-84-7

Formula: C₅H₆O₄

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 130.10

Ref: 3B-O0276

(2S)-(+)-5-Oxotetrahydrofuran-2-carboxylic acid

CAS: 21461-84-7

(2S)-(+)-5-Oxotetrahydrofuran-2-carboxylic acid

Formula: C₅H₆O₄

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 130.10g/mol

Ref: 54-OR22101