CAS 214623-57-1

5-amino-2-methoxybenzonitrile

Description:

5-Amino-2-methoxybenzonitrile is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a nitrile group (-CN) attached to a benzene ring. This compound features a substituted aromatic structure, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the methoxy group can influence the compound's solubility and electronic properties. The nitrile group, known for its polar nature, can also engage in various chemical transformations. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its physical properties, such as melting point and solubility, are influenced by the functional groups present. Overall, 5-amino-2-methoxybenzonitrile is a versatile compound with significant implications in synthetic organic chemistry and drug development.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-11-8-3-2-7(10)4-6(8)5-9/h2-4H,10H2,1H3

SMILES: COc1ccc(cc1C#N)N

Synonyms:

• Benzonitrile, 5-Amino-2-Methoxy-

Benzonitrile, 5-amino-2-methoxy- (9CI)

CAS: 214623-57-1

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA00C26D

5-Amino-2-methoxybenzonitrile

CAS: 214623-57-1

5-Amino-2-methoxybenzonitrile

Formula: C₈H₈N₂O

Purity: 97%

Color and Shape: solid

Molecular weight: 148.16g/mol

Ref: 54-OR400063

2-Methoxy-5-aminobenzonitrile

CAS: 214623-57-1

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 148.165

Ref: 10-F228024

5-Amino-2-methoxybenzonitrile

CAS: 214623-57-1

Please enquire for more information about 5-Amino-2-methoxybenzonitrile including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₈N₂O

Purity: Min. 95%

Molecular weight: 148.16 g/mol

Ref: 3D-FA116318