CAS 21463-31-0

(6R)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine

Description:

(6R)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine, with the CAS number 21463-31-0, is a chemical compound characterized by its thiazine ring structure, which incorporates sulfur and nitrogen atoms. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity. The presence of the methyl group at the 6-position contributes to its steric and electronic properties, influencing its reactivity and interaction with biological systems. As a thiazine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, it may have applications in pharmaceuticals or agrochemicals, given the significance of thiazine derivatives in medicinal chemistry. Understanding its characteristics, including its molecular geometry and functional groups, is essential for predicting its behavior in chemical reactions and potential applications in various fields.

Formula: C₅H₁₀N₂S

InChI: InChI=1/C5H10N2S/c1-4-2-3-7-5(6)8-4/h4H,2-3H2,1H3,(H2,6,7)/t4-/m1/s1

SMILES: C[C@@H]1CCNC(=N)S1

Synonyms:

• AMT HYDROCHLORIDE

AMT Hydrochloride

CAS: 21463-31-0

AMT Hydrochloride is a synthetic tryptamine compound, which is derived from chemical synthesis methods. It is an analogue of alpha-methyltryptamine (AMT), specifically the hydrochloride salt form, enhancing its stability and solubility for laboratory settings. The mode of action involves acting as a non-selective agonist at serotonin receptors, primarily targeting the 5-HT2C and 5-HT2A receptors. This interaction results in psychoactive effects through the modulation of neurotransmitter systems, impacting serotonin pathways.

Formula: C₅H₁₀N₂S·HCl

Purity: Min. 95%

Molecular weight: 130.21 g/mol

Ref: 3D-WAA46331

AMT hydrochloride

CAS: 21463-31-0

AMT hydrochloride is an iNOS inhibitor.

Formula: C₅H₁₁ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.67

Ref: TM-T22569