CAS 214697-26-4

5-(3-Bromophenyl)-7-[6-(4-morpholinyl)pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine

Description:

5-(3-Bromophenyl)-7-[6-(4-morpholinyl)pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-amine is a complex organic compound characterized by its multi-ring structure, which includes a pyrido[2,3-d]pyrimidine core. This compound features a bromophenyl group and a morpholinyl-substituted pyridine, contributing to its potential biological activity. The presence of the bromine atom enhances its lipophilicity and may influence its interaction with biological targets. The morpholine moiety is known for its ability to form hydrogen bonds, which can enhance the compound's solubility and binding affinity in biological systems. This compound is likely to exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific enzymes or receptors. Its structural complexity suggests potential for diverse interactions in biological pathways, making it a candidate for further investigation in drug discovery and development. As with many such compounds, its efficacy and safety would need to be evaluated through rigorous pharmacological studies.

Formula: C₂₂H₂₁BrCl₂N₆O

InChI: InChI=1/C22H19BrN6O.2ClH/c23-16-3-1-2-14(10-16)17-11-18(28-22-20(17)21(24)26-13-27-22)15-4-5-19(25-12-15)29-6-8-30-9-7-29;;/h1-5,10-13H,6-9H2,(H2,24,26,27,28);2*1H

SMILES: c1cc(cc(c1)Br)c1cc(c2ccc(nc2)N2CCOCC2)nc2c1c(N)ncn2.Cl.Cl

Synonyms:

• Abt-702
• 5-(3-Bromophenyl)-7-[6-(4-morpholinyl)pyridin-3-yl]pyrido[2,3-d]pyrimidin-4-ylamine
• 5-(3-Bromophenyl)-7-(6-Morpholino-3-Pyridyl)Pyrido[3,2-E]Pyrimidin-4-Amine Dihydrochloride

ABT-702

CAS: 214697-26-4

ABT-702 is an orally active, competitive, and reversible non-nucleoside adenosine kinase (AK) inhibitor analgesic and anti-inflammatory.

Formula: C₂₂H₁₉BrN₆O

Purity: 99.57%

Color and Shape: Soild

Molecular weight: 463.33

Ref: TM-T4668L

ABT-702

CAS: 214697-26-4

ABT-702

Purity: ≥98%

Molecular weight: 463.33g/mol

Ref: 54-BUP22133

5-(3-Bromophenyl)-7-[6-(4-morpholinyl)-3-pyridinyl]pyrido[2,3-d]pyrimidin-4-amine

Controlled Product

CAS: 214697-26-4

Formula: C₂₂H₁₉BrN₆O

Color and Shape: Neat

Molecular weight: 463.33

Ref: TR-B325700