CAS 214701-31-2

1-(6-Chloropyridazin-3-yl)ethanone

Description:

1-(6-Chloropyridazin-3-yl)ethanone, with the CAS number 214701-31-2, is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 6-position of the pyridazine ring contributes to its reactivity and potential biological activity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical properties, such as polarity and solubility. This compound may exhibit various characteristics, including moderate to high stability under standard conditions, and it may participate in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the chloropyridazine moiety may enhance biological activity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally.

Formula: C₆H₅ClN₂O

InChI: InChI=1/C6H5ClN2O/c1-4(10)5-2-3-6(7)9-8-5/h2-3H,1H3

SMILES: CC(=O)c1ccc(Cl)nn1

Synonyms:

• 3-Acetyl-6-chloropyridazine
• Ethanone, 1-(6-Chloro-3-Pyridazinyl)-

1-(6-Chloropyridazin-3-yl)ethanone

CAS: 214701-31-2

Formula: C₆H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.5697

Ref: IN-DA0038W3

1-(6-Chloropyridazin-3-yl)ethan-1-one

CAS: 214701-31-2

1-(6-Chloropyridazin-3-yl)ethan-1-one

Purity: 97%

Color and Shape: Solid

Molecular weight: 156.57g/mol

Ref: 54-OR948492

3-Acetyl-6-chloropyridazine

CAS: 214701-31-2

Formula: C₆H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.57

Ref: 10-F214853