CAS 21472-33-3
:5-benzoyl-1,3-dihydro-2H-benzimidazol-2-one
Description:
5-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one is a chemical compound characterized by its unique structure, which includes a benzimidazole core with a benzoyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the carbonyl group in the benzoyl moiety. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the benzimidazole ring suggests potential biological activity, as many derivatives of benzimidazole are known for their pharmacological properties. Additionally, this compound may display solubility in organic solvents, which is common for similar aromatic compounds. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different chemical environments. Overall, 5-benzoyl-1,3-dihydro-2H-benzimidazol-2-one is a versatile compound with applications in research and industry.
Formula:C14H10N2O2
InChI:InChI=1/C14H10N2O2/c17-13(9-4-2-1-3-5-9)10-6-7-11-12(8-10)16-14(18)15-11/h1-8H,(H2,15,16,18)
SMILES:c1ccc(cc1)C(=O)c1ccc2c(c1)[nH]c(n2)O
Synonyms:- 2H-benzimidazol-2-one, 5-benzoyl-1,3-dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Benzoyl-1,3-dihydro-2H-benzo[d]imidazol-2-one
CAS:5-Benzoyl-1,3-dihydro-2H-benzo[d]imidazol-2-onePurity:97%Molecular weight:238.25g/molMebendazole EP Impurity B
CAS:Formula:C14H10N2O2Color and Shape:Off-White SolidMolecular weight:238.25(2-Hydroxy-1H-benzimidazol-5-yl)phenylmethanone
CAS:Formula:C14H10N2O2Color and Shape:NeatMolecular weight:238.245-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one
CAS:Controlled ProductApplications This compound contains a benzimidazolone moiety which has been seen to inhibit p38 MAP kinase , a crucial protein in the activation of biological factors related to psoriasis, rheumatoid arthritis and other inflammatory diseases.
References Hammach, A. et al.: Bioorg. Med. Chem. Lett., 16, 6316 (2006);Formula:C14H10N2O2Color and Shape:NeatMolecular weight:238.245-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one
CAS:5-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one is a synthetic compound that has been used as an impurity standard. This substance is also found in the drug product Loxapine (Loxitane) and is metabolized to the active ingredient loxapine. 5-Benzoyl-1,3-dihydro-2H-benzimidazol-2-one has not been shown to have any therapeutic effects.Formula:C14H10N2O2Purity:Min. 95%Molecular weight:238.24 g/mol





