CAS 21473-01-8: 2-Naphthylmagnesium bromide

Description:2-Naphthylmagnesium bromide is an organomagnesium compound, specifically a Grignard reagent, characterized by its naphthyl group bonded to a magnesium atom, which is also associated with a bromide ion. This compound typically appears as a colorless to light yellow solution when dissolved in an appropriate solvent, such as diethyl ether or tetrahydrofuran. It is highly reactive, particularly with water and moisture, leading to the formation of naphthalene and magnesium hydroxide, which makes it essential to handle under an inert atmosphere. 2-Naphthylmagnesium bromide is utilized in organic synthesis for the formation of carbon-carbon bonds, allowing for the introduction of the naphthyl group into various organic molecules. Its reactivity can be attributed to the nucleophilic nature of the naphthyl anion, which can attack electrophiles, facilitating a range of synthetic transformations. Due to its reactivity, it is crucial to store this compound in a dry, airtight container to prevent degradation and ensure safety during handling.

Formula:C₁₀H₇BrMg

InChI:InChI=1/C10H7.BrH.Mg/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-3,5-8H;1H;/q-1;;+2/p-1

Synonyms:
Magnesium Bromide Naphthalen-2-Ide (1:1:1)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-Naphthylmagnesium bromide, 0.5M solution in THF, AcroSeal™ REF: AC-43174CAS: 109-99-9 21473-01-8	- - -	To inquire	Tue 29 Apr 25
	2-Naphthylmagnesium bromide REF: 3D-WAA47301CAS: 21473-01-8	Min. 95%	- - -	Discontinued product