
CAS 214748-66-0
:(5Z,9β,11β,12α,13E,15S)-9,11,15-Trihydroxyprosta-5,13-dien-1-oic acid
Description:
The chemical substance known as (5Z,9β,11β,12α,13E,15S)-9,11,15-Trihydroxyprosta-5,13-dien-1-oic acid, with the CAS number 214748-66-0, is a member of the prostaglandin family, which are bioactive lipids derived from arachidonic acid. This compound features multiple hydroxyl groups, indicating its potential for strong hydrogen bonding and solubility in polar solvents. Its structure includes a series of double bonds and a carboxylic acid functional group, which contribute to its reactivity and biological activity. Prostaglandins are known for their roles in various physiological processes, including inflammation, pain modulation, and regulation of blood flow. The specific stereochemistry of this compound, denoted by the various stereocenters, is crucial for its biological function, as it influences how the molecule interacts with specific receptors in the body. Overall, this compound exemplifies the complexity and significance of prostaglandins in biochemistry and pharmacology.
Formula:C20H34O5
InChI:InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17-,18+,19-/m0/s1
InChI key:InChIKey=PXGPLTODNUVGFL-XNTKLVSTSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@@H]1[C@H](/C=C/[C@H](CCCCC)O)[C@@H](O)C[C@H]1O
Synonyms:- (5Z,9β,11β,12α,13E,15S)-9,11,15-Trihydroxyprosta-5,13-dien-1-oic acid
- Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-, (5Z,9β,11β,12α,13E,15S)-
- ent-8-iso-15(S)-Prostaglandin F2α
- ent-8-iso-15(S)-Prostaglandin F-2α,ent8iso15(S)Prostaglandin F2α,ent 8 iso 15(S) Prostaglandin F2α
- PXGPLTODNUVGFL-XNTKLVSTSA-N
- ent-8-iso-15(R)-Prostaglandin F2.alpha.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ent-8-iso-15(S)-Prostaglandin F2α
CAS:<p>Isoprostanes are produced by the non-enzymatic, free radical peroxidation of phospholipid-esterified arachidonic acid.</p>Formula:C20H34O5Color and Shape:SolidMolecular weight:354.48
