CymitQuimica logo

CAS 214758-41-5

:

2-(1,3-benzodioxol-5-yloxy)pyridine-3-carboxylic acid

Description:
2-(1,3-benzodioxol-5-yloxy)pyridine-3-carboxylic acid, with the CAS number 214758-41-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a benzodioxole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid functional group. The benzodioxole portion may impart unique electronic properties, making it of interest in medicinal chemistry and drug design. Additionally, the presence of the pyridine ring suggests potential interactions with biological targets, such as enzymes or receptors. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its pharmacological properties, including anti-inflammatory or antimicrobial activities. As with many compounds, safety data should be consulted before handling, as it may pose health risks depending on exposure routes.
Formula:C13H9NO5
InChI:InChI=1/C13H9NO5/c15-13(16)9-2-1-5-14-12(9)19-8-3-4-10-11(6-8)18-7-17-10/h1-6H,7H2,(H,15,16)
SMILES:c1cc(c(nc1)Oc1ccc2c(c1)OCO2)C(=O)O
Synonyms:
  • 2-(1,3-Benzodioxol-5-Yloxy)Nicotinic Acid
  • 3-Pyridinecarboxylic Acid, 2-(1,3-Benzodioxol-5-Yloxy)-
Found 2 products.