CAS 214759-74-7: 4-morpholinobenzylamine
Description:4-Morpholinobenzylamine is an organic compound characterized by the presence of a morpholine ring and a benzylamine structure. It features a morpholine moiety, which is a six-membered ring containing both oxygen and nitrogen atoms, contributing to its potential as a versatile building block in medicinal chemistry. The benzylamine part of the molecule consists of a benzene ring attached to an amine group, which enhances its reactivity and solubility in various solvents. This compound is often studied for its biological activity, particularly in the context of drug development, as it may exhibit properties such as anti-cancer or anti-inflammatory effects. Its molecular structure allows for various functionalizations, making it a candidate for further chemical modifications. Additionally, 4-morpholinobenzylamine may interact with biological targets through hydrogen bonding and other non-covalent interactions, which are crucial for its potential therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, due to its potential biological activity.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c12-9-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-9,12H2
- Synonyms:
- (4-Morpholinophenyl)Methanamine
- [4-(Morpholin-4-yl)benzyl]amine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-MORPHOLINOBENZYLAMINE REF: IN-DA00BCPJCAS: 214759-74-7 | 98% | To inquire | Fri 28 Mar 25 |
 | 4-(Morpholin-4-yl)benzylamine REF: 54-OR23269CAS: 214759-74-7 | By hplc: 98% (Typical Value in Batch COA) | To inquire | Fri 04 Apr 25 |
 | 4-Morpholin-4-yl-benzylamine REF: 10-F065359CAS: 214759-74-7 | 97.0% | To inquire | Mon 07 Apr 25 |
 | 1-(4-Morpholin-4-ylphenyl)methanamine dihydrochloride REF: 3D-FM116645CAS: 214759-74-7 | Min. 95% | - - - | Discontinued product |
4-MORPHOLINOBENZYLAMINE
Ref: IN-DA00BCPJ
| 1g | 125.00 € | ||
| 5g | 294.00 € | ||
| 25g | To inquire | ||
| 100mg | 46.00 € | ||
| 250mg | 52.00 € |
4-(Morpholin-4-yl)benzylamine
Ref: 54-OR23269
| Undefined size | To inquire |
4-Morpholin-4-yl-benzylamine
Ref: 10-F065359
| 1g | 83.00 € | ||
| 5g | 229.00 € | ||
| 250mg | 54.00 € |
1-(4-Morpholin-4-ylphenyl)methanamine dihydrochloride
Ref: 3D-FM116645
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
