CAS 21477-57-6
:5-oxoprolylglutaminylalanine
Description:
5-Oxoprolylglutaminylalanine, identified by its CAS number 21477-57-6, is a peptide that consists of a sequence of amino acids, specifically incorporating the amino acids proline, glutamine, and alanine. This compound features a 5-oxoproline moiety, which is a cyclic derivative of glutamic acid, contributing to its unique properties. Peptides like this one are often studied for their biological activities, including potential roles in cellular signaling, metabolism, and as precursors in protein synthesis. The presence of the 5-oxoproline group may influence the peptide's stability, solubility, and interaction with biological targets. Additionally, the specific arrangement of amino acids can affect its conformation and functionality, making it of interest in biochemical research and potential therapeutic applications. As with many peptides, its characteristics can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment. Further studies are often required to fully elucidate its biological roles and potential applications in medicine or biotechnology.
Formula:C13H20N4O6
InChI:InChI=1/C13H20N4O6/c1-6(13(22)23)15-11(20)8(2-4-9(14)18)17-12(21)7-3-5-10(19)16-7/h6-8H,2-5H2,1H3,(H2,14,18)(H,15,20)(H,16,19)(H,17,21)(H,22,23)
SMILES:CC(C(=O)O)N=C(C(CCC(=N)O)N=C(C1CCC(=N1)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Eisenin
CAS:<p>Eisenin shows the activity as a biological response modifier isolated from brown marine algae, Eisenia bicyclis Setchell.</p>Formula:C13H20N4O6Color and Shape:SolidMolecular weight:328.32
