CAS 2148-38-1

5-Bromo-4-chloroquinazoline

Description:

5-Bromo-4-chloroquinazoline is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound features two halogen substituents: a bromine atom at the 5-position and a chlorine atom at the 4-position of the quinazoline ring. It is typically a crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of halogen atoms can influence the compound's reactivity and solubility, making it a useful scaffold for further chemical modifications. Additionally, 5-Bromo-4-chloroquinazoline may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects can vary based on the context of its use. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₄BrClN₂

InChI: InChI=1/C8H4BrClN2/c9-5-2-1-3-6-7(5)8(10)12-4-11-6/h1-4H

SMILES: c1cc(c2c(c1)ncnc2Cl)Br

Synonyms:

• Quinazoline, 5-bromo-4-chloro-

5-bromo-4-chloroquinazoline

CAS: 2148-38-1

Formula: C₈H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.4878

Ref: IN-DA00386O

5-Bromo-4-chloroquinazoline

CAS: 2148-38-1

5-Bromo-4-chloroquinazoline

Purity: 98%

Molecular weight: 243.49g/mol

Ref: 54-OR94645

5-Bromo-4-chloroquinazoline

CAS: 2148-38-1

Formula: C₈H₄BrClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.49

Ref: 10-F093265