CAS 214907-33-2

4-Methyl-1-pentenylboronic acid

Description:

4-Methyl-1-pentenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pentene chain with a methyl substituent. This compound typically exhibits a colorless to pale yellow appearance and is soluble in polar solvents such as water and alcohols due to the presence of the boronic acid group, which can form hydrogen bonds. It is known for its reactivity, particularly in cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The boronic acid moiety allows for the formation of stable complexes with diols, which is useful in various applications, including sensor technology and drug delivery systems. Additionally, 4-Methyl-1-pentenylboronic acid can participate in Suzuki-Miyaura coupling reactions, facilitating the formation of carbon-carbon bonds. As with many organoboron compounds, it should be handled with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings.

Formula: C₆H₁₃BO₂

InChI: InChI=1/C6H13BO2/c1-6(2)4-3-5-7(8)9/h3,5-6,8-9H,4H2,1-2H3/b5-3+

Synonyms:

• [(1E)-4-methylpent-1-en-1-yl]boronic acid

(4-Methylpent-1-en-1-yl)boronic acid

CAS: 214907-33-2

Formula: C₆H₁₃BO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 127.9772

Ref: IN-DA003BWE

4-Methyl-1-pentenylboronic acid

CAS: 214907-33-2

4-Methyl-1-pentenylboronic acid

Purity: 98%

Molecular weight: 127.98g/mol

Ref: 54-OR361460

(4-Methylpent-1-en-1-yl)boronic acid

CAS: 214907-33-2

Formula: C₆H₁₃BO₂

Purity: 98%

Molecular weight: 127.98

Ref: 10-F217341