
CAS 21491-96-3
:Propanoic acid, 3-chloro-2,2-dimethyl-, methyl ester
Description:
Propanoic acid, 3-chloro-2,2-dimethyl-, methyl ester, with the CAS number 21491-96-3, is an organic compound characterized by its ester functional group, which is derived from propanoic acid. This compound features a chlorinated carbon chain, specifically with a chlorine atom attached to the third carbon of the propanoic acid backbone, and two methyl groups on the second carbon, contributing to its branched structure. As an ester, it is typically less polar than its corresponding acid, which can influence its solubility in various solvents. The presence of the chlorine atom can also impart unique reactivity and properties, such as potential biological activity or environmental persistence. In terms of physical properties, esters generally have pleasant odors and can be used in flavoring and fragrance applications. Additionally, they may serve as intermediates in organic synthesis or as solvents in various chemical processes. Safety data should be consulted for handling and storage, as chlorinated compounds can pose specific health and environmental risks.
Formula:C6H11ClO2
InChI:InChI=1S/C6H11ClO2/c1-6(2,4-7)5(8)9-3/h4H2,1-3H3
InChI key:InChIKey=CKYBSQGDQJXNSB-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(CCl)(C)C
Synonyms:- Propanoic acid, 3-chloro-2,2-dimethyl-, methyl ester
- Methyl 3-chloro-2,2-dimethylpropionate
- Propionic acid, 3-chloro-2,2-dimethyl-, methyl ester
- Methyl 3-chloro-2,2-dimethyl-propanoate
- Methyl chloropivalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Methyl 3-chloro-2,2-dimethylpropanoate
CAS:<p>Methyl 3-chloro-2,2-dimethylpropanoate is a drug that inhibits the sodium-dependent glucose cotransporter. It is used as a pharmaceutical to treat diabetes mellitus type 2. Methyl 3-chloro-2,2-dimethylpropanoate binds to the cotransporter and prevents it from transporting glucose into cells. The stereoisomers of this drug are enantiomers and have opposite effects on the cotransporter.<br>Methyl 3-chloro-2,2-dimethylpropanoate is also used for other medical purposes such as to prevent kidney damage in children with renal failure and to treat seizures in children with epilepsy.</p>Formula:C6H11ClO2Purity:Min. 95%Molecular weight:150.6 g/mol
