CAS 214917-68-7
:2,6-Difluoro-4-hydroxybenzoic acid
Description:
2,6-Difluoro-4-hydroxybenzoic acid is an aromatic compound characterized by the presence of two fluorine atoms and a hydroxyl group attached to a benzoic acid structure. Its molecular formula is C7H5F2O3, indicating that it contains seven carbon atoms, five hydrogen atoms, two fluorine atoms, and three oxygen atoms. This compound typically exhibits properties associated with benzoic acids, such as being a weak acid due to the carboxylic acid functional group. The presence of fluorine atoms can enhance its lipophilicity and influence its reactivity, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxyl group contributes to its ability to form hydrogen bonds, which can affect its solubility in polar solvents. Additionally, the compound may exhibit unique biological activities due to its structural features, making it of interest in medicinal chemistry. As with many fluorinated compounds, it may also possess distinct physical properties, such as altered melting and boiling points compared to its non-fluorinated counterparts.
Formula:C7H4F2O3
InChI:InChI=1/C7H4F2O3/c8-4-1-3(10)2-5(9)6(4)7(11)12/h1-2,10H,(H,11,12)
SMILES:c1c(cc(c(c1F)C(=O)O)F)O
Synonyms:- Benzoic acid, 2,6-difluoro-4-hydroxy-
- Rarechem Al Bo 2259
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,6-Difluoro-4-hydroxybenzoic Acid
CAS:Formula:C7H4F2O3Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:174.102,6-Difluoro-4-hydroxybenzoic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H4F2O3Purity:95%Color and Shape:Powder, White to creamMolecular weight:174.12,6-Difluoro-4-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:98%Color and Shape:SolidMolecular weight:174.1017Ref: IN-DA00BCJY
1g56.00€5g141.00€10g210.00€25g587.00€50gTo inquire100gTo inquire250gTo inquire100mg25.00€250mg28.00€2,6-Difluoro-4-hydroxybenzoic acid
CAS:Formula:C7H4F2O3Purity:98%Color and Shape:Solid, Off-white powderMolecular weight:174.1032,6-Difluoro-4-hydroxybenzoic acid
CAS:2,6-Difluoro-4-hydroxybenzoic acidFormula:C7H4F2O3Purity:97%Color and Shape: solidMolecular weight:174.10g/mol2,6-Difluoro-4-hydroxybenzoic-d2 Acid
CAS:Controlled ProductFormula:C7D2H2F2O3Color and Shape:NeatMolecular weight:176.114





