CAS 2149591-37-5

Cyclopropanamine, 1-(2-thiazolyl)-, hydrochloride (1:1)

Description:

Cyclopropanamine, 1-(2-thiazolyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and a thiazole moiety, which is a five-membered ring containing both sulfur and nitrogen. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound may exhibit biological activity due to the presence of the thiazole ring, which is often found in various pharmaceuticals and biologically active molecules. The presence of the amine group suggests potential for hydrogen bonding and reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. As with many amines, it may also exhibit basic properties. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity. Further studies would be necessary to fully elucidate its properties, potential applications, and safety profile.

Formula: C₆H₈N₂S·ClH

InChI: InChI=1S/C6H8N2S.ClH/c7-6(1-2-6)5-8-3-4-9-5;/h3-4H,1-2,7H2;1H

InChI key: InChIKey=BRGVESABJKNOEZ-UHFFFAOYSA-N

SMILES: NC1(CC1)C2=NC=CS2.Cl

Synonyms:

• Cyclopropanamine, 1-(2-thiazolyl)-, hydrochloride (1:1)

1-Thiazol-2-ylcyclopropanamine hydrochloride

CAS: 2149591-37-5

1-Thiazol-2-ylcyclopropanamine hydrochloride

Purity: ≥95%

Molecular weight: 176.67g/mol

Ref: 54-OR480102