CAS 21499-66-1: (1beta,11beta,12alpha,15beta)-1,11,12,14,15-pentahydroxy-13,20-epoxypicras-3-ene-2,16-dione
Description:The chemical substance known as "(1beta,11beta,12alpha,15beta)-1,11,12,14,15-pentahydroxy-13,20-epoxypicras-3-ene-2,16-dione," with the CAS number 21499-66-1, is a complex organic compound characterized by its polyhydroxylated structure and the presence of an epoxide functional group. This compound belongs to the class of natural products, specifically derived from plants, and is often studied for its potential biological activities, including anti-inflammatory and anticancer properties. The multiple hydroxyl groups contribute to its solubility in polar solvents and may enhance its reactivity in biochemical pathways. The epoxide moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the specific stereochemistry indicated by the nomenclature suggests a unique three-dimensional arrangement that may influence its interaction with biological targets. Overall, this compound exemplifies the intricate chemistry found in natural products and their potential applications in pharmaceuticals and biochemistry.
Formula:C20H26O9
InChI:InChI=1S/C20H26O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8,10-15,22-25,27H,5-6H2,1-3H3/t8-,10+,11+,12+,13+,14-,15-,17-,18+,19+,20+/m0/s1
InChI key:InChIKey=JBDMZGKDLMGOFR-KQSRGDCESA-N
SMILES:O=C1OC2CC3C(=CC(=O)C(O)C3(C)C4C(O)C(O)C5(OCC24C5(O)C1O)C)C
