CAS 2150-45-0
:Benzoic acid, 2,6-dihydroxy-, methyl ester
Description:
Benzoic acid, 2,6-dihydroxy-, methyl ester, commonly known as methyl 2,6-dihydroxybenzoate, is an organic compound characterized by its ester functional group derived from benzoic acid. It features two hydroxyl (-OH) groups located at the 2 and 6 positions of the benzene ring, which contribute to its solubility and reactivity. This compound typically appears as a white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but less so in water due to its hydrophobic aromatic structure. Methyl 2,6-dihydroxybenzoate exhibits antioxidant properties and is often studied for its potential applications in pharmaceuticals and cosmetics. Its molecular structure allows for hydrogen bonding, which can influence its physical properties and interactions with other substances. Additionally, it may serve as a precursor in the synthesis of various chemical compounds, highlighting its importance in organic chemistry and industrial applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4,9-10H,1H3
InChI key:InChIKey=WCQZCKUNZVMBDC-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=CC=C1O
Synonyms:- 2,6-Dihydroxy-benzoic acid methylester
- 2,6-Dihydroxybenzioc acid methyl ester
- 2,6-Dihydroxybenzoic acid methyl ester
- Benzoic acid, 2,6-dihydroxy-, methyl ester
- γ-Resorcylic acid, methyl ester
- Methyl 2,6-dihydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methyl 2,6-dihydroxybenzoate
CAS:Formula:C8H8O4Purity:98%Color and Shape:SolidMolecular weight:168.1467Methyl 2,6-dihydroxybenzoate
CAS:Methyl 2,6-dihydroxybenzoate is a natural benzoate ester suitable for biochemical experiments and drug synthesis research.Formula:C8H8O4Purity:99.65%Color and Shape:SolidMolecular weight:168.15Methyl 2,6-Dihydroxybenzoate
CAS:Formula:C8H8O4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:168.15Methyl 2,6-dihydroxybenzoate
CAS:Formula:C8H8O4Purity:95%~99%Color and Shape:PowderMolecular weight:168.148Methyl 2,6-dihydroxybenzoate
CAS:Methyl 2,6-dihydroxybenzoatePurity:98%Color and Shape:White SolidMolecular weight:168.15g/molMethyl 2,6-dihydroxybenzoate
CAS:Methyl 2,6-dihydroxybenzoate is a molecule that contains a hydroxyl group in its structure. It can be used to diagnose certain metabolic disorders, such as indian citric aciduria and 4-methoxystilbene synthase deficiency. Methyl 2,6-dihydroxybenzoate also has the ability to form an intramolecular hydrogen bond with itself. This ability makes it an effective inhibitor of phosphatases that are involved in the metabolism of glycerolipids and lipoproteins.
Formula:C8H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:168.15 g/molMethyl 2,6-dihydroxybenzoate
CAS:Formula:C8H8O4Purity:98%Color and Shape:Solid, White to pale reddish yellow powderMolecular weight:168.148






