CAS 2150-48-3
:Pyronine B
Description:
Pyronine B, with the CAS number 2150-48-3, is a synthetic dye belonging to the class of xanthene dyes. It is characterized by its vibrant red to pink color, which makes it useful in various applications, including biological staining and as a pH indicator. Pyronine B exhibits solubility in water and organic solvents, which enhances its utility in laboratory settings. The compound is often used in histology and cytology for staining nucleic acids, particularly RNA, due to its affinity for these biomolecules. Its fluorescence properties allow for visualization under specific light conditions, making it valuable in microscopy. Additionally, Pyronine B has been studied for its potential applications in the fields of biochemistry and molecular biology. However, like many synthetic dyes, it should be handled with care, as it may pose health risks if ingested or if it comes into contact with skin. Proper safety protocols should be followed when working with this substance in a laboratory environment.
Formula:C21H27N2O·Cl
InChI:InChI=1S/C21H27N2O.ClH/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=CXZRDVVUVDYSCQ-UHFFFAOYSA-M
SMILES:N(CC)(CC)C1=CC2=C(C=C3C(=[O+]2)C=C(N(CC)CC)C=C3)C=C1.[Cl-]
Synonyms:- Ammonium, [6-(diethylamino)-3H-xanthen-3-ylidene]diethyl-, chloride
- Ethanaminium, N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, chloride
- N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride
- N-[6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride trichloroiron (1:1)
- Pyronin B
- Pyronine B
- Pyronine B(By)
- Xanthylium, 3,6-bis(diethylamino)-, chloride
- Xanthylium, 3,6-bis(diethylamino)-, chloride (1:1)
- [6-(Diethylamino)-3H-xanthen-3-ylidene]diethylammonium chloride
- C.I. 45010
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Xanthylium, 3,6-bis(diethylamino)-, chloride
CAS:Formula:C21H27ClN2OPurity:%Color and Shape:SolidMolecular weight:358.9049Pyronin B ferric chloride complex
CAS:Formula:C42H54Cl8Fe2N4O2Color and Shape:Green or red crystalsMolecular weight:1042.22Pyronine B
CAS:Pyronine B is a reagent of biochemical.Formula:C21H27ClN2OPurity:98%Color and Shape:SolidMolecular weight:358.91Pyronin B
CAS:Pyronin B Certified is a fluorescent dye that is used in biological and environmental applications. It has been shown to have photophysical and surfactant properties, with a disulfide bond that can be cleaved by reducing agents. Pyronin B certified has been used in the analysis of biological samples, such as human serum and wastewater, due to its ability to bind proteins. This dye can also be used as a fluorescence probe for electrochemical impedance spectroscopy, which is an analytical technique used for determining the concentration of ions in solution.Formula:C42H54Cl8Fe2N4OPurity:60%Min (Dye Content)Molecular weight:1,026.22 g/mol





