CAS 2151-18-0
:5-ethyl-4,6-dimethylbenzene-1,2,3-triol
Description:
5-Ethyl-4,6-dimethylbenzene-1,2,3-triol, also known as 2,3,4-trihydroxy-5-ethyl-6-methyl toluene, is an organic compound characterized by its aromatic structure featuring a benzene ring substituted with three hydroxyl (–OH) groups and additional alkyl groups. The presence of multiple hydroxyl groups indicates that it is a polyol, which can exhibit significant solubility in water and may participate in hydrogen bonding. The ethyl and methyl substituents contribute to its hydrophobic character, influencing its overall solubility and reactivity. This compound may exhibit antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. Its structural complexity suggests potential applications in pharmaceuticals, agrochemicals, or as a chemical intermediate. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C10H14O3
InChI:InChI=1/C10H14O3/c1-4-7-5(2)8(11)10(13)9(12)6(7)3/h11-13H,4H2,1-3H3
SMILES:CCc1c(C)c(c(c(c1C)O)O)O
Synonyms:- 1,2,3-Trihydroxy-4,6-dimethyl-5-ethylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Barnol
CAS:Barnol is a potent kinase inhibitor that has shown promising results in the treatment of tumors and cancers. It works by blocking the activity of kinases, which are enzymes that play a key role in cancer cell growth and survival. Barnol has been shown to induce apoptosis (programmed cell death) in cancer cells, making it a promising anticancer agent. This medicinal compound is an analog of a protein found in human urine and has been used traditionally in Chinese medicine for its anti-cancer properties. With its strong inhibitory effects on kinases, Barnol holds great potential as a therapeutic agent for various types of cancer.Formula:C10H14O3Purity:Min. 95%Molecular weight:182.22 g/mol
