CymitQuimica logo

CAS 215124-03-1

:

5-chloro-2-hydroxy-3-iodobenzaldehyde

Description:
5-Chloro-2-hydroxy-3-iodobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of chlorine and iodine substituents on the benzene ring, along with a hydroxyl group, contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the hydroxyl group, while the halogen substituents can influence its reactivity and potential applications in synthesis. The chlorine atom can enhance electrophilic substitution reactions, while the iodine atom may facilitate nucleophilic attacks. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties such as boiling and melting points. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in organic synthesis. As with many halogenated compounds, it is essential to handle it with care, considering the environmental and health implications associated with halogenated organic substances.
Formula:C7H4ClIO2
InChI:InChI=1/C7H4ClIO2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H
InChI key:QNSRWUDUYCZRQJ-UHFFFAOYSA-N
SMILES:c1c(C=O)c(c(cc1Cl)I)O
Synonyms:
  • Benzaldehyde, 5-Chloro-2-Hydroxy-3-Iodo-
Found 4 products.