CAS 21517-30-6

6-hydrazinyl[1,2,4]triazolo[3,4-a]phthalazine

Description:

6-Hydrazinyl[1,2,4]triazolo[3,4-a]phthalazine is a heterocyclic compound characterized by its unique triazole and phthalazine structures. This compound features a hydrazine functional group, which contributes to its reactivity and potential biological activity. The presence of the triazole ring enhances its properties, making it of interest in medicinal chemistry, particularly for its potential as an antitumor or antimicrobial agent. The molecular structure includes nitrogen atoms that can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the compound may exhibit various physical properties such as melting point and solubility, which are essential for its application in pharmaceuticals. Its CAS number, 21517-30-6, allows for easy identification and reference in chemical databases. Overall, 6-hydrazinyl[1,2,4]triazolo[3,4-a]phthalazine represents a class of compounds that may have significant implications in drug development and research.

Formula: C₉H₈N₆

InChI: InChI=1/C9H8N6/c10-12-8-6-3-1-2-4-7(6)9-13-11-5-15(9)14-8/h1-5H,10H2,(H,12,14)

SMILES: c1ccc2c(c1)c(=NN)[nH]n1cnnc21

Synonyms:

• 1,2,4-Triazolo[3,4-a]phthalazine, 6-hydrazinyl-
• 6-Hydrazino[1,2,4]triazolo[3,4-a]phthalazine

6-Hydrazino[1,2,4]triazolo[3,4-a]phthalazine

CAS: 21517-30-6

6-Hydrazino[1,2,4]triazolo[3,4-a]phthalazine

Purity: 95%

Molecular weight: 200.2g/mol

Ref: 54-OR1064509

6-Hydrazino[1,2,4]triazolo[3,4-a]phthalazine

CAS: 21517-30-6

Purity: 95.0%

Molecular weight: 200.2050018310547

Ref: 10-F061306