CAS 215190-19-5
:1-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-phenylpiperidine-4-carboxylic acid
Description:
1-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-phenylpiperidine-4-carboxylic acid, commonly referred to as Fmoc-4-phenylpiperidine-4-carboxylic acid, is a chemical compound used primarily in peptide synthesis as a protecting group for amino acids. This compound features a piperidine ring, which contributes to its basicity and steric properties, making it suitable for various synthetic applications. The presence of the fluorenylmethoxycarbonyl (Fmoc) group provides stability during the synthesis process and allows for selective deprotection under mild conditions, typically using a base. The phenyl substituent enhances the compound's lipophilicity, influencing its solubility and reactivity. Additionally, the carboxylic acid functional group is crucial for coupling reactions in peptide synthesis. Overall, this compound is valued in organic chemistry and biochemistry for its role in facilitating the formation of peptide bonds while maintaining the integrity of the amino acid side chains during synthesis.
Formula:C27H25NO4
InChI:InChI=1/C27H25NO4/c29-25(30)27(19-8-2-1-3-9-19)14-16-28(17-15-27)26(31)32-18-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-13,24H,14-18H2,(H,29,30)
SMILES:c1ccc(cc1)C1(CCN(CC1)C(=O)OCC1c2ccccc2c2ccccc12)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
