CAS 2152-70-7
:1,5-Bis(5-nitro-2-furanyl)-1,4-pentadien-3-one
Description:
1,5-Bis(5-nitro-2-furanyl)-1,4-pentadien-3-one, with the CAS number 2152-70-7, is an organic compound characterized by its complex structure featuring two nitro-substituted furan rings attached to a pentadienone backbone. This compound exhibits notable properties such as a high degree of conjugation due to the presence of multiple double bonds, which can contribute to its electronic and optical characteristics. The nitro groups on the furan rings enhance its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's furan moieties can impart unique solubility and stability properties, affecting its behavior in different solvents. Its potential applications may include use as a precursor in organic synthesis or as a component in the development of novel pharmaceuticals. However, specific handling precautions should be observed due to the presence of nitro groups, which can pose safety concerns. Overall, this compound represents a fascinating example of the interplay between structure and reactivity in organic chemistry.
Formula:C13H8N2O7
InChI:InChI=1/C13H8N2O7/c16-9(1-3-10-5-7-12(21-10)14(17)18)2-4-11-6-8-13(22-11)15(19)20/h1-8H/b3-1-,4-2+
InChI key:InChIKey=LUWVSMYASMXSJY-UHFFFAOYSA-N
SMILES:C(=CC(C=CC=1OC(N(=O)=O)=CC1)=O)C=2OC(N(=O)=O)=CC2
Synonyms:- 1,4-Pentadien-3-one, 1,5-bis(5-nitro-2-furyl)-
- 1,5-Bis(5-nitro-2-furanyl)-1,4-pentadien-3-one
- 1,4-Pentadien-3-one, 1,5-bis(5-nitro-2-furanyl)-
- 3-Pentadienone, 1,5-bis(5-nitro-2-furyl)-
- 1,5-Bis(5-nitro-2-furyl)-1,4-pentadien-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
