CAS 2152-75-2
:α-D-Glucosamine 1-phosphate
Description:
α-D-Glucosamine 1-phosphate is an amino sugar derivative of glucose, characterized by the presence of an amino group and a phosphate group attached to the first carbon of the glucose molecule. This compound plays a crucial role in various biological processes, particularly in the synthesis of glycoproteins and glycolipids, which are essential for cell membrane structure and function. It is involved in metabolic pathways, including those related to amino sugar metabolism and nucleotide sugar biosynthesis. The presence of the phosphate group contributes to its reactivity and solubility in aqueous environments, making it a key intermediate in cellular metabolism. α-D-Glucosamine 1-phosphate is typically found in its phosphorylated form, which enhances its biological activity and interaction with other biomolecules. Its CAS number, 2152-75-2, is used for identification in chemical databases and regulatory contexts. Overall, this compound is significant in biochemistry and molecular biology, particularly in the context of cellular signaling and structural integrity.
Formula:C6H14NO8P
InChI:InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4-,5-,6-/m1/s1
InChI key:InChIKey=YMJBYRVFGYXULK-QZABAPFNSA-N
SMILES:O(P(=O)(O)O)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N
Synonyms:- 2-Amino-2-deoxy-α-<span class="text-smallcaps">D</span>-glucopyranosyl phosphate
- 2-amino-2-deoxy-1-O-phosphono-alpha-D-glucopyranose
- 2-amino-2-deoxy-1-O-phosphonohexopyranose
- Glucosamine 1-phosphate
- alpha-D-Glucopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate)
- α-<span class="text-smallcaps">D</span>-Glucopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate)
- α-<span class="text-smallcaps">D</span>-Glucosamine 1-phosphate
- α-D-Glucosamine 1-phosphate
- α-D-Glucopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate)
- 2-Amino-2-deoxy-α-D-glucopyranosyl phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucosamine 1-phosphate
CAS:Formula:C6H14NO8PPurity:≥ 97.0%Color and Shape:White powderMolecular weight:259.15α-D-Glucosamine 1-phosphate
CAS:α-D-Glucosamine 1-phosphate is a methylated and glycosylated carbohydrate that is synthesized from glucose. It can be used as a building block for the synthesis of polysaccharides, such as chitin and cellulose. α-D-Glucosamine 1-phosphate can also be modified by fluorination to produce an active form with potent anticancer activity.Formula:C6H14NO8PPurity:Min. 95%Molecular weight:259.15 g/mol


