CymitQuimica logo

CAS 215229-16-6

:

(4Z)-3-(ammoniomethyl)-4-(methoxyimino)pyrrolidinium dichloride

Description:
(4Z)-3-(ammoniomethyl)-4-(methoxyimino)pyrrolidinium dichloride is a chemical compound characterized by its unique pyrrolidine structure, which features a methoxyimino group and an ammoniomethyl substituent. This compound is typically a quaternary ammonium salt, indicated by the presence of the ammonium group, which contributes to its solubility in polar solvents, such as water. The dichloride component suggests that it contains two chloride ions, which can influence its ionic properties and stability. The specific stereochemistry denoted by (4Z) indicates a particular geometric configuration around the double bond in the pyrrolidine ring, which can affect its reactivity and interaction with biological systems. This compound may exhibit biological activity, potentially serving as a pharmacological agent or a research tool in medicinal chemistry. Its properties, such as melting point, solubility, and reactivity, would be influenced by the functional groups present and the overall molecular structure. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C6H15Cl2N3O
InChI:InChI=1/C6H13N3O.2ClH/c1-10-9-6-4-8-3-5(6)2-7;;/h5,8H,2-4,7H2,1H3;2*1H/b9-6+;;
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.