CymitQuimica logo

CAS 215229-17-7

:

1-Amino-1,4-cyclohexanedicarboxylic acid

Description:
1-Amino-1,4-cyclohexanedicarboxylic acid, also known as ACHD, is an organic compound characterized by its cyclohexane ring structure with two carboxylic acid groups and one amino group. This compound is a derivative of cyclohexane, featuring a symmetrical arrangement that contributes to its unique properties. It is typically a white crystalline solid that is soluble in water due to the presence of the polar carboxylic acid and amino functional groups. The compound exhibits both acidic and basic characteristics, allowing it to participate in various chemical reactions, such as forming salts or undergoing esterification. Its structure enables it to act as a potential building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, 1-amino-1,4-cyclohexanedicarboxylic acid may play a role in biochemical processes, particularly in the context of amino acid metabolism. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H13NO4
InChI:InChI=1S/C8H13NO4/c9-8(7(12)13)3-1-5(2-4-8)6(10)11/h5H,1-4,9H2,(H,10,11)(H,12,13)
InChI key:InChIKey=JDQXFBXJCBUSRJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)CCC(C(O)=O)CC1
Synonyms:
  • NSC 619576
  • 1,4-Cyclohexanedicarboxylic acid, 1-amino-
  • 1-Amino-1,4-cyclohexanedicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.