CymitQuimica logo

CAS 21531-96-4

:

4-Amino-4H-1,2,4-Triazole-3,5-Diol

Description:
4-Amino-4H-1,2,4-Triazole-3,5-Diol, with the CAS number 21531-96-4, is an organic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features amino and hydroxyl functional groups, contributing to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in biological systems. The presence of the amino group allows for hydrogen bonding, influencing its interaction with other molecules. This compound is of interest for its potential as a plant growth regulator and as a precursor in the synthesis of other nitrogen-containing compounds. Additionally, its triazole structure is significant in medicinal chemistry, particularly in the development of antifungal agents. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper laboratory practices.
Formula:C2H4N4O2
InChI:InChI=1/C2H4N4O2/c3-6-1(7)4-5-2(6)8/h3H2,(H,4,7)(H,5,8)
SMILES:c1(nnc(n1N)O)O
Synonyms:
  • 4-Amino-1,2,4-Triazolidine-3,5-Dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.