CAS 2153472-96-7

Pyridazine, 5-chloro-3-methyl-, hydrochloride (1:1)

Description:

Pyridazine, 5-chloro-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 5-position and a methyl group at the 3-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure allows for potential interactions with various biological targets, which could lead to applications in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, pyridazine derivatives like this one are valuable in the synthesis of more complex molecules and can serve as intermediates in various chemical reactions.

Formula: C₅H₅ClN₂·ClH

InChI: InChI=1S/C5H5ClN2.ClH/c1-4-2-5(6)3-7-8-4;/h2-3H,1H3;1H

InChI key: InChIKey=QVOQQZNRWXTGBJ-UHFFFAOYSA-N

SMILES: ClC=1C=C(C)N=NC1.Cl

Synonyms:

• Pyridazine, 5-chloro-3-methyl-, hydrochloride (1:1)

5-Chloro-3-methylpyridazine hydrochloride

CAS: 2153472-96-7

Versatile small molecule scaffold

Formula: C₅H₆Cl₂N₂

Purity: Min. 95%

Molecular weight: 165 g/mol

Ref: 3D-DLD47296