CAS 2154-32-7
:[3-(methoxycarbonyl)-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-1-yl]oxidanyl
Description:
The chemical substance known as [3-(methoxycarbonyl)-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-1-yl]oxidanyl, with the CAS number 2154-32-7, is a complex organic compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is further substituted with a methoxycarbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple methyl groups indicates a degree of steric hindrance, which can influence its chemical behavior and interactions. Additionally, the oxidanyl group suggests the presence of a hydroxyl functional group, which may enhance its solubility in polar solvents and affect its hydrogen bonding capabilities. This compound may exhibit interesting properties such as stability under certain conditions, potential for forming derivatives, and utility in various chemical reactions, including those in medicinal chemistry or materials science. Overall, its unique structure and functional groups make it a subject of interest for further research and application in various fields of chemistry.
Formula:C10H16NO3
InChI:InChI=1/C10H16NO3/c1-9(2)6-7(8(12)14-5)10(3,4)11(9)13/h6H,1-5H3
SMILES:CC1(C)C=C(C(=O)OC)C(C)(C)N1O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methoxycarbonyl-2,2,5,5-tetramethyl-3-pyrrolidin-1-oxyl
CAS:Controlled ProductApplications A spin label.
Formula:C10H18NO3Color and Shape:NeatMolecular weight:200.25
