CymitQuimica logo

CAS 215434-25-6

:

5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride

Description:
5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a thiophene ring and a thiazole moiety. This compound features a sulfonyl chloride functional group, making it a reactive sulfonyl chloride derivative. It is typically used in organic synthesis, particularly in the preparation of sulfonamide compounds and other derivatives due to its electrophilic nature. The presence of the thiazole and thiophene rings contributes to its potential biological activity, as these heterocycles are often found in pharmacologically active compounds. The compound is likely to be a solid at room temperature and may exhibit moderate to high solubility in polar organic solvents. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or alcohols. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry for its versatile reactivity and potential applications.
Formula:C8H6ClNO2S3
InChI:InChI=1/C8H6ClNO2S3/c1-5-10-6(4-13-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3
SMILES:Cc1nc(cs1)c1ccc(s1)S(=O)(=O)Cl
Synonyms:
  • 2-Thiophenesulfonyl chloride, 5-(2-methyl-4-thiazolyl)-
  • 5-(2-Methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride
Found 3 products.