CAS 215434-40-5

2-{4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol

Description:

2-{4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol, with the CAS number 215434-40-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyridine moiety. The presence of a chloro group and a trifluoromethyl group on the pyridine ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents due to the hydroxyl group (-OH) present in its structure. The piperazine component may impart certain pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions with biological targets can be influenced by the electron-withdrawing trifluoromethyl group and the chlorine substituent, which can affect lipophilicity and binding affinity. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological applications.

Formula: C₁₂H₁₅ClF₃N₃O

InChI: InChI=1/C12H15ClF3N3O/c13-10-7-9(12(14,15)16)8-17-11(10)19-3-1-18(2-4-19)5-6-20/h7-8,20H,1-6H2

SMILES: C1CN(CCN1CCO)c1c(cc(cn1)C(F)(F)F)Cl

Synonyms:

• 1-Piperazineethanol, 4-[3-Chloro-5-(Trifluoromethyl)-2-Pyridinyl]-
• 2-{4-[3-Chloro-5-(Trifluoromethyl)-2-Pyridyl]Piperazino}Ethan-1-Ol
• 2-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol

2-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol

CAS: 215434-40-5

2-{4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol

Purity: ≥95%

Molecular weight: 309.72g/mol

Ref: 54-PC300675

2-{4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol

CAS: 215434-40-5

Formula: C₁₂H₁₅ClF₃N₃O

Molecular weight: 309.72

Ref: 10-F518629