CAS 21550-48-1: 6-(acetylamino)pyridine-3-carboxylic acid

Description:6-(Acetylamino)pyridine-3-carboxylic acid, with the CAS number 21550-48-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an acetylamino group and a carboxylic acid functional group, contributing to its reactivity and solubility in polar solvents. The presence of the acetylamino group enhances its potential for hydrogen bonding, which can influence its biological activity and interactions with other molecules. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in acid-base reactions. The compound is typically used in pharmaceutical research and synthesis, particularly in the development of biologically active molecules. Its structural characteristics suggest potential applications in medicinal chemistry, where modifications to the pyridine ring or functional groups can lead to compounds with desired therapeutic effects. Overall, 6-(acetylamino)pyridine-3-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.

Formula:C₈H₈N₂O₃

InChI:InChI=1/C8H8N2O3/c1-5(11)10-7-3-2-6(4-9-7)8(12)13/h2-4H,1H3,(H,12,13)(H,9,10,11)

Synonyms:
3-Pyridinecarboxylic Acid, 6-(Acetylamino)-
6-Acetamidonicotinic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
6-Acetamidonicotinic acid REF: IN-DA0038W2CAS: 21550-48-1	97%	59.00 €~1,404.00 €	Mon 14 Apr 25
6-Acetamidonicotinic acid REF: 54-OR5583CAS: 21550-48-1	tech	32.00 €~251.00 €	Tue 15 Apr 25
6-Acetamidonicotinic acid REF: 10-F209829CAS: 21550-48-1	95.0%	- - -	Discontinued product
6-Acetamidonicotinic acid REF: 3D-FA156085CAS: 21550-48-1	Min. 95%	- - -	Discontinued product