CAS 215519-35-0

3-[(4-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-amine

Description:

3-[(4-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-amine is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms. The presence of the 4-fluorophenylmethyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's electronic properties and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anti-inflammatory properties. The oxadiazole moiety is known for its diverse biological activities, making this compound of interest in medicinal chemistry. Additionally, the presence of the amine functional group can participate in hydrogen bonding, which may enhance its interactions with biological targets. As with many chemical substances, safety data and handling precautions should be considered, as the specific toxicity and environmental impact would depend on its concentration and exposure routes.

Formula: C₉H₈FN₃O

InChI: InChI=1S/C9H8FN3O/c10-7-3-1-6(2-4-7)5-8-12-9(11)14-13-8/h1-4H,5H2,(H2,11,12,13)

InChI key: InChIKey=SOEJAETWBKZKOE-UHFFFAOYSA-N

SMILES: C(C=1N=C(N)ON1)C2=CC=C(F)C=C2

Synonyms:

• 3-[(4-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-amine
• 1,2,4-Oxadiazol-5-amine, 3-[(4-fluorophenyl)methyl]-

3-[(4-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-amine

CAS: 215519-35-0

Versatile small molecule scaffold

Formula: C₉H₈FN₃O

Purity: Min. 95%

Molecular weight: 193.18 g/mol

Ref: 3D-QIA51935