CAS 21554-71-2
:Dihydrogenistein
Description:
Dihydrogenistein, with the CAS number 21554-71-2, is a chemical compound that belongs to the class of flavonoids, specifically a derivative of the isoflavonoid group. It is characterized by its structure, which includes multiple hydroxyl groups that contribute to its potential antioxidant properties. Dihydrogenistein is often studied for its biological activities, including its effects on cell signaling pathways and its potential role in health benefits, such as anti-inflammatory and anti-cancer properties. The compound is soluble in organic solvents and may exhibit varying solubility in water, depending on the pH and other conditions. Its reactivity can be influenced by the presence of functional groups, making it a subject of interest in both synthetic and natural product chemistry. Research into dihydrogenistein continues to explore its pharmacological potential and mechanisms of action, particularly in relation to human health and disease prevention.
Formula:C15H12O5
InChI:InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-6,11,16-18H,7H2
InChI key:InChIKey=UQGVUYNHDKMLSE-UHFFFAOYSA-N
SMILES:O=C1C=2C(OCC1C3=CC=C(O)C=C3)=CC(O)=CC2O
Synonyms:- Isoflavanone, 4′,5,7-trihydroxy-
- 2,3-Dihydro-5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
- Dihydrogenistein
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-3-(4-hydroxyphenyl)-
- 4′,5,7-Trihydroxyisoflavan-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dihydrogenistein
CAS:Controlled ProductStability Hygroscopic
Applications Dihydrogenistein is a derivative of Genistein (G350000), a compound that exhibits specific inhibitory activity against tyrosine kinases,including autophosphorylation of epidermal growth factor receptor kinase.
References McLaughlin, J.M., et al.: Cancer. Prevent. Res., 5, 496 (2012); Magiera, S., et al.: J. Pharma. Biomed. Anal., 56, 93 (2011);Formula:C15H12O5Color and Shape:BeigeMolecular weight:272.255,7,4'-Trihydroxyisoflavanone
CAS:5,7,4'-Trihydroxyisoflavanone is a bioactive isoflavonoid, which is typically derived from various plant sources, including legumes and certain medicinal herbs. This compound belongs to the class of natural products known as isoflavonoids, which are structurally characterized by the presence of a 3-phenylchroman skeleton.Formula:C15H12O5Purity:Min. 95%Color and Shape:White to beige solid.Molecular weight:272.25 g/molDihydrogenistein
CAS:Dihydrogenistein, derived from Genistein, inhibits tyrosine kinases and EGF receptor autophosphorylation.Formula:C15H12O5Color and Shape:SolidMolecular weight:272.25


