CAS 215543-92-3: 2-[(1,2-Dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoic acid
Description:2-[(1,2-Dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoic acid, with the CAS number 215543-92-3, is a chemical compound that features a complex structure incorporating both pyrrole and indole moieties. This compound is characterized by its unique combination of functional groups, which may contribute to its potential biological activity. The presence of the indole ring suggests possible interactions with biological systems, as indole derivatives are often associated with various pharmacological properties. The pyrrole ring adds to the compound's aromatic character and may influence its reactivity and solubility. Additionally, the propanoic acid group indicates that the compound has acidic properties, which could affect its behavior in different pH environments. Overall, this compound's structural features suggest it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-10-9-18-15(11(10)6-7-16(20)21)8-13-12-4-2-3-5-14(12)19-17(13)22/h2-5,8-9,18H,6-7H2,1H3,(H,19,22)(H,20,21)
InChI key:InChIKey=JNDVEAXZWJIOKB-UHFFFAOYSA-N
SMILES:O=C(O)CCC1=C(C=C2C(=O)NC=3C=CC=CC32)NC=C1C
- Synonyms:
- 1H-Pyrrole-3-propanoic acid, 2-[(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-
- 1H-Pyrrole-3-propanoic acid, 2-[(Z)-(1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-
- 2-[(1,2-Dihydro-2-oxo-3H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-3-propanoic acid
- 3-[3-(2-Carboxyethyl)-4-methylpyrrol-2-methylidenyl]-2-indolinone
- 3-[4-Methyl-2-[(2-Oxo-1H-Indol-3-Ylidene)Methyl]-1H-Pyrrol-3-Yl]Propanoic Acid
- Su-5402
- 3-{4-Methyl-2-[(Z)-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl}propanoic acid