CAS 21556-79-6

N-(3-hydroxyphenyl)butanamide

Description:

N-(3-hydroxyphenyl)butanamide, also known by its CAS number 21556-79-6, is an organic compound characterized by its amide functional group and a hydroxyphenyl moiety. This compound features a butanamide backbone, which consists of a four-carbon chain terminating in an amide group, and a phenolic hydroxyl group positioned at the meta position relative to the amide linkage. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. N-(3-hydroxyphenyl)butanamide may exhibit various properties such as moderate melting and boiling points, depending on its molecular interactions. Its structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the significance of phenolic compounds in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it relevant in both synthetic and biological contexts. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c1-2-4-10(13)11-8-5-3-6-9(12)7-8/h3,5-7,12H,2,4H2,1H3,(H,11,13)

SMILES: CCCC(=Nc1cccc(c1)O)O

Synonyms:

• butanamide, N-(3-hydroxyphenyl)-
• N-(3-Hydroxyphenyl)butanamide

N-(3-hydroxyphenyl)butanamide

CAS: 21556-79-6

Formula: C₁₀H₁₃NO₂

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 179.219

Ref: 10-F309916