
CAS 215597-83-4
:1,5-Bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) pentanedioate
Description:
1,5-Bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) pentanedioate, identified by its CAS number 215597-83-4, is a synthetic organic compound characterized by its complex molecular structure. It features a pentanedioate backbone, which is a five-carbon dicarboxylic acid derivative, and is substituted with two pyrrolidine rings that contain sulfonic acid and diketone functionalities. This compound is likely to exhibit strong solubility in polar solvents due to the presence of sulfonic acid groups, which enhance its ionic character. The diketone moieties may contribute to its reactivity, potentially allowing for various chemical transformations. Additionally, the presence of multiple functional groups suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological and chemical systems. Its unique structure may also impart specific properties, such as potential applications in pharmaceuticals, materials science, or as a reagent in organic synthesis. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H14N2O14S2
InChI:InChI=1S/C13H14N2O14S2/c16-8-4-6(30(22,23)24)12(20)14(8)28-10(18)2-1-3-11(19)29-15-9(17)5-7(13(15)21)31(25,26)27/h6-7H,1-5H2,(H,22,23,24)(H,25,26,27)
InChI key:InChIKey=OWSWOWLMQKUWTE-UHFFFAOYSA-N
SMILES:O(C(CCCC(ON1C(=O)C(S(=O)(=O)O)CC1=O)=O)=O)N2C(=O)C(S(=O)(=O)O)CC2=O
Synonyms:- Pentanedioic acid, 1,5-bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) ester
- 3-Pyrrolidinesulfonic acid, 1,1′-[(1,5-dioxo-1,5-pentanediyl)bis(oxy)]bis[2,5-dioxo-
- 1,5-Bis(2,5-dioxo-3-sulfo-1-pyrrolidinyl) pentanedioate
- Bis(sulfosuccinimidyl) glutarate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BS2G Crosslinker
CAS:BS2G, a water-soluble, amine-reactive crosslinker, labels cell surface proteins; can't cross cell membranes.Formula:C13H14N2O14S2Color and Shape:SolidMolecular weight:486.38
