CAS 21562-57-2

(11α,13E,15S)-1,11,15-Trihydroxyprost-13-en-9-one

Description:

The chemical substance known as (11α,13E,15S)-1,11,15-Trihydroxyprost-13-en-9-one, with the CAS number 21562-57-2, is a member of the prostaglandin family, which are bioactive lipids involved in various physiological processes. This compound features a complex structure characterized by a cyclopentane ring and multiple hydroxyl (-OH) groups, which contribute to its reactivity and biological activity. The presence of the double bond in the enone structure indicates potential for electrophilic reactions. Its stereochemistry, denoted by the specific configuration at the 11, 15 positions, plays a crucial role in its interaction with biological receptors, influencing its pharmacological effects. Prostaglandins like this compound are known to participate in processes such as inflammation, pain modulation, and regulation of vascular tone. The tri-hydroxy substitution pattern enhances its solubility and reactivity, making it a significant molecule in medicinal chemistry and pharmacology. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the prostaglandin class.

Formula: C₂₀H₃₆O₄

InChI: InChI=1S/C20H36O4/c1-2-3-7-10-16(22)12-13-18-17(19(23)15-20(18)24)11-8-5-4-6-9-14-21/h12-13,16-18,20-22,24H,2-11,14-15H2,1H3/b13-12+/t16-,17+,18+,20+/m0/s1

InChI key: InChIKey=CMHCOGHTKXUQKW-KOAZGICHSA-N

SMILES: C(CCCCCCO)[C@@H]1[C@@H](/C=C/[C@H](CCCCC)O)[C@H](O)CC1=O

Synonyms:

• Prost-13-en-9-one, 1,11,15-trihydroxy-, (11α,13E,15S)-
• (11α,13E,15S)-1,11,15-Trihydroxyprost-13-en-9-one
• Cyclopentanone, 4-hydroxy-2-(7-hydroxyheptyl)-3-(3-hydroxy-1-octenyl)-, stereoisomer
• 3-Hydroxy-2-(3-hydroxy-1-octenyl)-5-oxocyclopentaneheptanol
• 1-Decarboxy-1-hydroxymethyl-PGE1

TR4161

CAS: 21562-57-2

TR4161 is a prostaglandin bronchodilator of low tracheobronchial irritancy.

Formula: C₂₀H₃₆O₄

Color and Shape: Solid

Molecular weight: 340.5

Ref: TM-T34913