CAS 21563-29-1

4-Bromo-1,8-Naphthalic Anhydride

Description:

4-Bromo-1,8-Naphthalic Anhydride is an organic compound characterized by its anhydride functional group and a bromine substituent on the naphthalene ring. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as acetone and dichloromethane, but is generally insoluble in water. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including acylation and as a building block in organic synthesis. This compound is often employed in the production of dyes, pharmaceuticals, and agrochemicals due to its ability to participate in electrophilic aromatic substitution reactions. Additionally, 4-Bromo-1,8-Naphthalic Anhydride can serve as a reagent in the synthesis of other complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.

Formula: C₁₂H₅BrO₃

InChI: InChI=1/C12H5BrO3/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5H

SMILES: c1cc2c(ccc3c2c(c1)C(=O)OC3=O)Br

Synonyms:

• 1H,3H-Naphtho(1,8-cd)pyran-1,3-dione, 6-bromo-
• 6-bromo-1H,3H-benzo[de]isochromene-1,3-dione

4-Bromobenzo[de]isochromene-1,3-dione

CAS: 21563-29-1

Formula: C₁₂H₅BrO₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 277.0703

Ref: IN-DA003KUR

4-Bromobenzo[de]isochromene-1,3-dione

CAS: 21563-29-1

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 277.072998046875

Ref: 10-F462794