CAS 215655-20-2

1-(2-chloro-6-fluorobenzyl)piperazine

Description:

1-(2-Chloro-6-fluorobenzyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-chloro-6-fluorobenzyl group attached to the piperazine ring contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological and psychiatric conditions. The chlorine and fluorine substituents can influence the compound's lipophilicity, receptor binding affinity, and overall pharmacokinetic profile. Additionally, the compound's structure suggests potential interactions with neurotransmitter systems, which could be explored in drug design. As with many piperazine derivatives, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 1-(2-chloro-6-fluorobenzyl)piperazine represents a significant structure in the realm of chemical research and development.

Formula: C₁₁H₁₄ClFN₂

InChI: InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2

SMILES: c1cc(c(CN2CCNCC2)c(c1)F)Cl

1-[(2-Chloro-6-fluorophenyl)methyl]piperazine

CAS: 215655-20-2

Formula: C₁₁H₁₄ClFN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.6937

Ref: IN-DA007PX7

1-(2-Chloro-6-fluorobenzyl)piperazine

Controlled Product

CAS: 215655-20-2

Please enquire for more information about 1-(2-Chloro-6-fluorobenzyl)piperazine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₄ClFN₂

Purity: Min. 95%

Molecular weight: 228.69 g/mol

Ref: 3D-FC83738