CAS 215655-21-3

2-Methyl-3-[5-(methylthio)-1,3,4-oxadiazol-2-yl]-6-(trifluoromethyl)pyridine

Description:

2-Methyl-3-[5-(methylthio)-1,3,4-oxadiazol-2-yl]-6-(trifluoromethyl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a trifluoromethyl group and an oxadiazole moiety. The presence of the methylthio group enhances its chemical reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen and sulfur in its structure. It may exhibit various properties such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The trifluoromethyl group is known to impart unique electronic properties, potentially enhancing the compound's stability and reactivity. Additionally, the oxadiazole ring is often associated with biological activity, making this compound of interest in pharmaceutical research. Overall, the unique combination of functional groups in 2-Methyl-3-[5-(methylthio)-1,3,4-oxadiazol-2-yl]-6-(trifluoromethyl)pyridine suggests potential applications in medicinal chemistry and agrochemicals.

Formula: C₁₀H₈F₃N₃OS

InChI: InChI=1S/C10H8F3N3OS/c1-5-6(8-15-16-9(17-8)18-2)3-4-7(14-5)10(11,12)13/h3-4H,1-2H3

InChI key: InChIKey=AOFNOJJLNOMAHQ-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(C(F)(F)F)=N1)C=2OC(SC)=NN2

Synonyms:

• ICT 5040
• 2-Methyl-3-[5-(methylthio)-1,3,4-oxadiazol-2-yl]-6-(trifluoromethyl)pyridine
• 2-(2-Methyl-6-(trifluoromethyl)pyridin-3-yl)-5-(methylthio)-1,3,4-oxadiazole
• Pyridine, 2-methyl-3-[5-(methylthio)-1,3,4-oxadiazol-2-yl]-6-(trifluoromethyl)-
• ICT5040

2-Methyl-3-(5-methylsulfanyl-[1,3,4]oxadiazol-2-yl)-6-trifluoromethyl-pyridine

CAS: 215655-21-3

2-Methyl-3-(5-methylsulfanyl-[1,3,4]oxadiazol-2-yl)-6-trifluoromethyl-pyridine (SCH58261) is a ligand of G protein coupled receptors. It binds to the receptor and activates it by increasing the permeability of ion channels. SCH58261 has been shown to interact with various ion channels such as nicotinic acetylcholine receptor, dopamine receptor, and serotonin receptor. SCH58261 is a potent inhibitor of the activation of β1 adrenergic receptor. It also inhibits the binding of agonists to α1A adrenergic receptor and α2C adrenergic receptor.

Formula: C₁₀H₈F₃N₃OS

Purity: Min. 95%

Molecular weight: 275.25 g/mol

Ref: 3D-QIA65521

ICT5040

CAS: 215655-21-3

ICT5040 is a CXCR4 antagonist.

Formula: C₁₀H₈F₃N₃OS

Color and Shape: Solid

Molecular weight: 275.25

Ref: TM-T25523