CAS 21571-66-4

4-(ethylsulfonyl)benzoic acid

Description:

4-(Ethylsulfonyl)benzoic acid is an organic compound characterized by its benzoic acid structure, where a sulfonyl group is substituted at the para position with an ethyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The ethylsulfonyl moiety enhances its solubility and may influence its reactivity and biological activity. It is often utilized in pharmaceutical research and development, particularly in the synthesis of various bioactive compounds. The presence of the sulfonyl group can impart unique properties, such as increased stability and potential for hydrogen bonding, which may affect its interactions in biological systems. Additionally, 4-(ethylsulfonyl)benzoic acid may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as it may have specific toxicity or environmental considerations.

Formula: C₉H₁₀O₄S

InChI: InChI=1/C9H10O4S/c1-2-14(12,13)8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11)

SMILES: CCS(=O)(=O)c1ccc(cc1)C(=O)O

4-(Ethanesulfonyl)benzoic acid

CAS: 21571-66-4

Versatile small molecule scaffold

Formula: C₉H₁₀O₄S

Purity: Min. 95%

Molecular weight: 214.24 g/mol

Ref: 3D-WAA57166