CymitQuimica logo

CAS 21573-09-1

:

4-Chloro-6-cyclopropyl-2-pyrimidinamine

Description:
4-Chloro-6-cyclopropyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a chloro group at the 4-position and a cyclopropyl group at the 6-position contributes to its unique chemical properties. This compound is typically classified as an amine due to the amino group (-NH2) attached to the pyrimidine ring. It is often studied for its potential biological activity, particularly in medicinal chemistry, where modifications to the pyrimidine structure can influence pharmacological properties. The compound may exhibit various interactions with biological targets, making it of interest in drug development. Additionally, its solubility, stability, and reactivity can be influenced by the substituents on the pyrimidine ring, which can affect its applications in research and industry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H8ClN3
InChI:InChI=1S/C7H8ClN3/c8-6-3-5(4-1-2-4)10-7(9)11-6/h3-4H,1-2H2,(H2,9,10,11)
InChI key:InChIKey=KXBBHTZHROZBCL-UHFFFAOYSA-N
SMILES:ClC1=CC(C2CC2)=NC(N)=N1
Synonyms:
  • 2-Amino-4-chloro-6-cyclopropylpyrimidine
  • 2-Pyrimidinamine, 4-chloro-6-cyclopropyl-
  • 4-Chloro-6-cyclopropyl-2-pyrimidinamine
  • 4-Chloro-6-cyclopropylpyrimidin-2-amine
  • Pyrimidine, 2-amino-4-chloro-6-cyclopropyl-
Found 4 products.