CAS 21573-29-5
:4-(acetylamino)-2-nitrobenzoic acid
Description:
4-(Acetylamino)-2-nitrobenzoic acid, with the CAS number 21573-29-5, is an organic compound characterized by its aromatic structure, which includes a nitro group and an acetylamino group attached to a benzoic acid framework. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. This compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or dyes. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro groups can be sensitive and potentially hazardous.
Formula:C9H8N2O5
InChI:InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-7(9(13)14)8(4-6)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14)
SMILES:CC(=Nc1ccc(c(c1)N(=O)=O)C(=O)O)O
Synonyms:- 4-Acetamido-2-nitrobenzoic acid
- Benzoic Acid, 4-(Acetylamino)-2-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(Acetylamino)-2-nitrobenzoic acid
CAS:<p>4-(Acetylamino)-2-nitrobenzoic acid (AAANB) is a versatile building block that can be used in the synthesis of a wide range of organic and pharmaceutical compounds. AAANB is an intermediate in the preparation of 4-Amino-3-nitrophenol, which is an important research chemical. This compound is a useful scaffold for the synthesis of organic compounds with various biological activities. The CAS number for this product is 21573-29-5.</p>Formula:C9H8N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:224.17 g/mol
