CAS 21577-57-1
:2-Amino-4,6-dimethoxybenzoic acid
Description:
2-Amino-4,6-dimethoxybenzoic acid, with the CAS number 21577-57-1, is an aromatic compound characterized by the presence of an amino group and two methoxy groups attached to a benzoic acid structure. This compound typically exhibits properties associated with both amines and carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The methoxy groups enhance its lipophilicity and can affect its biological activity. It is generally a white to off-white solid at room temperature and may be soluble in polar organic solvents. The presence of the amino group suggests potential for basicity, while the carboxylic acid group can participate in acid-base reactions. This compound may have applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its functional groups. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.
Formula:C9H11NO4
InChI:InChI=1/C9H11NO4/c1-13-5-3-6(10)8(9(11)12)7(4-5)14-2/h3-4H,10H2,1-2H3,(H,11,12)
SMILES:COc1cc(c(c(c1)OC)C(=O)O)N
Synonyms:- Benzoic Acid, 2-Amino-4,6-Dimethoxy-
- 2-Amino-4,6-dimethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-AMINO-4,6-DIMETHOXYBENZOIC ACID
CAS:Formula:C9H11NO4Purity:98%Color and Shape:SolidMolecular weight:197.18792-Amino-4,6-dimethoxybenzoic acid
CAS:2-Amino-4,6-dimethoxybenzoic acidPurity:98%Molecular weight:197.19g/mol2-Amino-4,6-dimethoxybenzoic acid
CAS:2-Amino-4,6-dimethoxybenzoic acid is an organic chemical compound that can be used as a building block for the synthesis of other compounds. 2-Amino-4,6-dimethoxybenzoic acid has a number of uses including being a reagent in organic and inorganic reactions, such as the synthesis of dyes, pharmaceuticals, and pesticides. It is also used as a building block for complex compounds that are difficult to make. This chemical has been classified by the Chemical Abstract Services (CAS) registry with CAS number 21577-57-1.
Formula:C9H11NO4Purity:Min. 95%Color and Shape:Yellow SolidMolecular weight:197.19 g/mol2-Amino-4,6-dimethoxybenzoic acid
CAS:Formula:C9H11NO4Purity:98%Color and Shape:SolidMolecular weight:197.19



