CAS 2158-02-3
:4-Morpholinecarboxamide
Description:
4-Morpholinecarboxamide, also known by its CAS number 2158-02-3, is an organic compound characterized by the presence of a morpholine ring and a carboxamide functional group. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, which enhances its utility in different chemical applications. The morpholine structure contributes to its basicity and potential as a nucleophile in chemical reactions. It is often used in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block or intermediate in organic synthesis. Additionally, 4-Morpholinecarboxamide may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many amides, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, its unique structural features and solubility properties make it a valuable compound in various chemical research and industrial applications.
Formula:C5H10N2O2
InChI:InChI=1S/C5H10N2O2/c6-5(8)7-1-3-9-4-2-7/h1-4H2,(H2,6,8)
InChI key:InChIKey=ZKWFSTHEYLJLEL-UHFFFAOYSA-N
SMILES:C(N)(=O)N1CCOCC1
Synonyms:- 4-Carbamoylmorpholine
- 4-Morpholinecarboxamide
- Ai3-61349
- Morpholine, 4-carbamoyl-
- Morpholine-N-carboxamide
- N-Carbamoylmorpholine
- NSC 10542
- Morpholine-4-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Morpholine-4-carboxamide
CAS:Formula:C5H10N2O2Purity:98%Color and Shape:SolidMolecular weight:130.1451Morpholine-4-carboxamide
CAS:Morpholine-4-carboxamide is a polymerase chain inhibitor that inhibits the activity of DNA polymerases. It binds to the DNA template strand and prevents the enzyme from adding nucleotides to the primer strand, thereby inhibiting DNA synthesis. Morpholine-4-carboxamide has shown efficacy in treating hyperproliferative diseases such as cancer cells and psoriasis. This drug has been shown to inhibit caspase activation and histone protein acetylation, which may be related to its anti-cancer properties. Morpholine-4-carboxamide also binds to cannabinoid receptor 2 (CB2) and may have therapeutic effects on inflammatory diseases such as psoriasis and arthritis.
Formula:C5H10N2O2Purity:Min. 95%Molecular weight:130.15 g/molRef: 3D-FM131592
Discontinued product



